C28H20IrNO4S- — CID 59622183
4-(7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaen-6-yl)-3H-dibenzothiophen-3-ide 5,5-dioxide;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 59622183) has the molecular formula C28H20IrNO4S- and a molecular weight of 658.76 g/mol. Its IUPAC name is 4-(7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaen-6-yl)-3H-dibenzothiophen-3-ide 5,5-dioxide;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 4-(7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaen-6-yl)-3H-dibenzothiophen-3-ide 5,5-dioxide;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 59622183 |
| Molecular Formula | C28H20IrNO4S- |
| Molecular Weight | 658.76 g/mol |
| Exact Mass | 659.07 |
| IUPAC Name | 4-(7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaen-6-yl)-3H-dibenzothiophen-3-ide 5,5-dioxide;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.O=S1(=O)c2ccccc2-c2cc[c-]c(-c3cc4c5c(cccc5n3)C=C4)c21.[Ir] |
| InChI | InChI=1S/C23H12NO2S.C5H8O2.Ir/c25-27(26)21-10-2-1-6-16(21)17-7-4-8-18(23(17)27)20-13-15-12-11-14-5-3-9-19(24-20)22(14)15;1-4(6)3-5(2)7;/h1-7,9-13H;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | UFZAMZNXBOCORE-LWFKIUJUSA-N |
| XLogP | 6.03 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.76 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|