C28H17IrN2O5S2- — CID 59621810
1-(7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaen-6-yl)-2H-dibenzothiophen-2-ide 5,5-dioxide;iridium;pyridine-2-sulfonic acid (PubChem CID 59621810) has the molecular formula C28H17IrN2O5S2- and a molecular weight of 717.80 g/mol. Its IUPAC name is 1-(7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaen-6-yl)-2H-dibenzothiophen-2-ide 5,5-dioxide;iridium;pyridine-2-sulfonic acid.
| Compound Name | 1-(7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaen-6-yl)-2H-dibenzothiophen-2-ide 5,5-dioxide;iridium;pyridine-2-sulfonic acid |
|---|---|
| PubChem CID | 59621810 |
| Molecular Formula | C28H17IrN2O5S2- |
| Molecular Weight | 717.80 g/mol |
| Exact Mass | 718.02 |
| IUPAC Name | 1-(7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaen-6-yl)-2H-dibenzothiophen-2-ide 5,5-dioxide;iridium;pyridine-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccccn1.O=S1(=O)c2ccccc2-c2c(-c3cc4c5c(cccc5n3)C=C4)[c-]ccc21.[Ir] |
| InChI | InChI=1S/C23H12NO2S.C5H5NO3S.Ir/c25-27(26)20-9-2-1-6-17(20)23-16(7-4-10-21(23)27)19-13-15-12-11-14-5-3-8-18(24-19)22(14)15;7-10(8,9)5-3-1-2-4-6-5;/h1-6,8-13H;1-4H,(H,7,8,9);/q-1;; |
| InChIKey | PZWWRQPLQUMJPK-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.80 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|