C33H22IrN3O3S- — CID 59622003
iridium;3-(9-methyl-2H-carbazol-2-id-3-yl)-4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene;pyridine-2-sulfonic acid (PubChem CID 59622003) has the molecular formula C33H22IrN3O3S- and a molecular weight of 732.84 g/mol. Its IUPAC name is iridium;3-(9-methyl-2H-carbazol-2-id-3-yl)-4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene;pyridine-2-sulfonic acid.
| Compound Name | iridium;3-(9-methyl-2H-carbazol-2-id-3-yl)-4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene;pyridine-2-sulfonic acid |
|---|---|
| PubChem CID | 59622003 |
| Molecular Formula | C33H22IrN3O3S- |
| Molecular Weight | 732.84 g/mol |
| Exact Mass | 733.10 |
| IUPAC Name | iridium;3-(9-methyl-2H-carbazol-2-id-3-yl)-4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene;pyridine-2-sulfonic acid |
| SMILES | Cn1c2c[c-]c(-c3cc4c5c(cccc5n3)-c3ccccc3-4)cc2c2ccccc21.O=S(=O)(O)c1ccccn1.[Ir] |
| InChI | InChI=1S/C28H17N2.C5H5NO3S.Ir/c1-30-26-12-5-4-9-20(26)22-15-17(13-14-27(22)30)25-16-23-19-8-3-2-7-18(19)21-10-6-11-24(29-25)28(21)23;7-10(8,9)5-3-1-2-4-6-5;/h2-12,14-16H,1H3;1-4H,(H,7,8,9);/q-1;; |
| InChIKey | ANENUNHQQKKKIF-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.84 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|