C26H17IrN2O3S- — CID 59621765
iridium;6-(3H-naphthalen-3-id-2-yl)-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene;pyridine-2-sulfonic acid (PubChem CID 59621765) has the molecular formula C26H17IrN2O3S- and a molecular weight of 629.72 g/mol. Its IUPAC name is iridium;6-(3H-naphthalen-3-id-2-yl)-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene;pyridine-2-sulfonic acid.
| Compound Name | iridium;6-(3H-naphthalen-3-id-2-yl)-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene;pyridine-2-sulfonic acid |
|---|---|
| PubChem CID | 59621765 |
| Molecular Formula | C26H17IrN2O3S- |
| Molecular Weight | 629.72 g/mol |
| Exact Mass | 630.06 |
| IUPAC Name | iridium;6-(3H-naphthalen-3-id-2-yl)-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene;pyridine-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccccn1.[Ir].[c-]1cc2ccccc2cc1-c1cc2c3c(cccc3n1)C=C2 |
| InChI | InChI=1S/C21H12N.C5H5NO3S.Ir/c1-2-5-16-12-17(10-8-14(16)4-1)20-13-18-11-9-15-6-3-7-19(22-20)21(15)18;7-10(8,9)5-3-1-2-4-6-5;/h1-9,11-13H;1-4H,(H,7,8,9);/q-1;; |
| InChIKey | CTOGUZUZBKGXDH-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.72 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|