C28H17IrN2O3S2- — CID 59621462
3-(3H-1-benzothiophen-3-id-2-yl)-4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene;iridium;pyridine-2-sulfonic acid (PubChem CID 59621462) has the molecular formula C28H17IrN2O3S2- and a molecular weight of 685.81 g/mol. Its IUPAC name is 3-(3H-1-benzothiophen-3-id-2-yl)-4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene;iridium;pyridine-2-sulfonic acid.
| Compound Name | 3-(3H-1-benzothiophen-3-id-2-yl)-4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene;iridium;pyridine-2-sulfonic acid |
|---|---|
| PubChem CID | 59621462 |
| Molecular Formula | C28H17IrN2O3S2- |
| Molecular Weight | 685.81 g/mol |
| Exact Mass | 686.03 |
| IUPAC Name | 3-(3H-1-benzothiophen-3-id-2-yl)-4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene;iridium;pyridine-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccccn1.[Ir].[c-]1c(-c2cc3c4c(cccc4n2)-c2ccccc2-3)sc2ccccc12 |
| InChI | InChI=1S/C23H12NS.C5H5NO3S.Ir/c1-4-11-21-14(6-1)12-22(25-21)20-13-18-16-8-3-2-7-15(16)17-9-5-10-19(24-20)23(17)18;7-10(8,9)5-3-1-2-4-6-5;/h1-11,13H;1-4H,(H,7,8,9);/q-1;; |
| InChIKey | ZBCGRZRDBNMULF-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.81 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|