C32H22IrNO4S- — CID 59621767
3-(4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaen-3-yl)-2H-dibenzothiophen-2-ide 5,5-dioxide;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 59621767) has the molecular formula C32H22IrNO4S- and a molecular weight of 708.82 g/mol. Its IUPAC name is 3-(4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaen-3-yl)-2H-dibenzothiophen-2-ide 5,5-dioxide;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 3-(4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaen-3-yl)-2H-dibenzothiophen-2-ide 5,5-dioxide;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 59621767 |
| Molecular Formula | C32H22IrNO4S- |
| Molecular Weight | 708.82 g/mol |
| Exact Mass | 709.09 |
| IUPAC Name | 3-(4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaen-3-yl)-2H-dibenzothiophen-2-ide 5,5-dioxide;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.O=S1(=O)c2ccccc2-c2c[c-]c(-c3cc4c5c(cccc5n3)-c3ccccc3-4)cc21.[Ir] |
| InChI | InChI=1S/C27H14NO2S.C5H8O2.Ir/c29-31(30)25-11-4-3-8-19(25)20-13-12-16(14-26(20)31)24-15-22-18-7-2-1-6-17(18)21-9-5-10-23(28-24)27(21)22;1-4(6)3-5(2)7;/h1-11,13-15H;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | RHAKHEXVMSNXPM-LWFKIUJUSA-N |
| XLogP | 7.20 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.82 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|