C27H21N — CID 59621843
6-[3-(4-ethenyl-2,6-dimethylphenyl)phenyl]-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene (PubChem CID 59621843) has the molecular formula C27H21N and a molecular weight of 359.47 g/mol. Its IUPAC name is 6-[3-(4-ethenyl-2,6-dimethylphenyl)phenyl]-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene.
| Compound Name | 6-[3-(4-ethenyl-2,6-dimethylphenyl)phenyl]-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene |
|---|---|
| PubChem CID | 59621843 |
| Molecular Formula | C27H21N |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 6-[3-(4-ethenyl-2,6-dimethylphenyl)phenyl]-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene |
| SMILES | C=Cc1cc(C)c(-c2cccc(-c3cc4c5c(cccc5n3)C=C4)c2)c(C)c1 |
| InChI | InChI=1S/C27H21N/c1-4-19-13-17(2)26(18(3)14-19)22-9-5-8-21(15-22)25-16-23-12-11-20-7-6-10-24(28-25)27(20)23/h4-16H,1H2,2-3H3 |
| InChIKey | TVNUXLHGDRGZHP-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |