C16H16 — CID 123205650
2-(3-ethenylphenyl)-1,3-dimethylbenzene (PubChem CID 123205650) has the molecular formula C16H16 and a molecular weight of 208.30 g/mol. Its IUPAC name is 2-(3-ethenylphenyl)-1,3-dimethylbenzene.
| Compound Name | 2-(3-ethenylphenyl)-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 123205650 |
| Molecular Formula | C16H16 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 2-(3-ethenylphenyl)-1,3-dimethylbenzene |
| SMILES | C=Cc1cccc(-c2c(C)cccc2C)c1 |
| InChI | InChI=1S/C16H16/c1-4-14-9-6-10-15(11-14)16-12(2)7-5-8-13(16)3/h4-11H,1H2,2-3H3 |
| InChIKey | OGHGEOBJPYVWPV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |