About 3-ethenylaniline;hydrochloride
3-ethenylaniline;hydrochloride (PubChem CID 70700938) has the molecular formula C8H10ClN
and a molecular weight of 155.63 g/mol. Its IUPAC name is 3-ethenylaniline;hydrochloride.
Molecular Properties
| Compound Name | 3-ethenylaniline;hydrochloride |
| PubChem CID | 70700938 |
| Molecular Formula | C8H10ClN |
| Molecular Weight | 155.63 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | 3-ethenylaniline;hydrochloride |
| SMILES | C=Cc1cccc(N)c1.Cl |
| InChI | InChI=1S/C8H9N.ClH/c1-2-7-4-3-5-8(9)6-7;/h2-6H,1,9H2;1H |
| InChIKey | XHVKJUHGISDIOC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.63 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenylaniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenylaniline;hydrochloride?
The IUPAC name of 3-ethenylaniline;hydrochloride (CID 70700938) is 3-ethenylaniline;hydrochloride.
What is the SMILES notation for 3-ethenylaniline;hydrochloride?
The canonical SMILES for 3-ethenylaniline;hydrochloride is C=Cc1cccc(N)c1.Cl.
What is the InChIKey of 3-ethenylaniline;hydrochloride?
The InChIKey is XHVKJUHGISDIOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N.ClH/c1-2-7-4-3-5-8(9)6-7;/h2-6H,1,9H2;1H.
What are the key properties of 3-ethenylaniline;hydrochloride?
3-ethenylaniline;hydrochloride has a molecular weight of 155.63 g/mol, XLogP of 2.33, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenylaniline;hydrochloride is sourced from PubChem (CID 70700938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).