C10H16Cl6Pt — CID 175502891
1,3-bis(ethenyl)benzene;platinum;hexahydrochloride (PubChem CID 175502891) has the molecular formula C10H16Cl6Pt and a molecular weight of 544.03 g/mol. Its IUPAC name is 1,3-bis(ethenyl)benzene;platinum;hexahydrochloride.
| Compound Name | 1,3-bis(ethenyl)benzene;platinum;hexahydrochloride |
|---|---|
| PubChem CID | 175502891 |
| Molecular Formula | C10H16Cl6Pt |
| Molecular Weight | 544.03 g/mol |
| Exact Mass | 540.90 |
| IUPAC Name | 1,3-bis(ethenyl)benzene;platinum;hexahydrochloride |
| SMILES | C=Cc1cccc(C=C)c1.Cl.Cl.Cl.Cl.Cl.Cl.[Pt] |
| InChI | InChI=1S/C10H10.6ClH.Pt/c1-3-9-6-5-7-10(4-2)8-9;;;;;;;/h3-8H,1-2H2;6*1H; |
| InChIKey | ZERNNTGCHQRMOO-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.03 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |