C32H38 — CID 160527972
styrene;1,2-xylene;1,3-xylene;1,4-xylene (PubChem CID 160527972) has the molecular formula C32H38 and a molecular weight of 422.66 g/mol. Its IUPAC name is styrene;1,2-xylene;1,3-xylene;1,4-xylene.
| Compound Name | styrene;1,2-xylene;1,3-xylene;1,4-xylene |
|---|---|
| PubChem CID | 160527972 |
| Molecular Formula | C32H38 |
| Molecular Weight | 422.66 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | styrene;1,2-xylene;1,3-xylene;1,4-xylene |
| SMILES | C=Cc1ccccc1.Cc1ccc(C)cc1.Cc1cccc(C)c1.Cc1ccccc1C |
| InChI | InChI=1S/3C8H10.C8H8/c1-7-3-5-8(2)6-4-7;1-7-4-3-5-8(2)6-7;1-7-5-3-4-6-8(7)2;1-2-8-6-4-3-5-7-8/h3*3-6H,1-2H3;2-7H,1H2 |
| InChIKey | QVDULANEQIYSBT-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.66 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |