About anthracene;1-ethenyl-4-methylbenzene
anthracene;1-ethenyl-4-methylbenzene (PubChem CID 174555561) has the molecular formula C23H20
and a molecular weight of 296.41 g/mol. Its IUPAC name is anthracene;1-ethenyl-4-methylbenzene.
Molecular Properties
| Compound Name | anthracene;1-ethenyl-4-methylbenzene |
| PubChem CID | 174555561 |
| Molecular Formula | C23H20 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | anthracene;1-ethenyl-4-methylbenzene |
| SMILES | C=Cc1ccc(C)cc1.c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H10.C9H10/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;1-3-9-6-4-8(2)5-7-9/h1-10H;3-7H,1H2,2H3 |
| InChIKey | SVZBLRFPEKYSQR-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene;1-ethenyl-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene;1-ethenyl-4-methylbenzene?
The IUPAC name of anthracene;1-ethenyl-4-methylbenzene (CID 174555561) is anthracene;1-ethenyl-4-methylbenzene.
What is the SMILES notation for anthracene;1-ethenyl-4-methylbenzene?
The canonical SMILES for anthracene;1-ethenyl-4-methylbenzene is C=Cc1ccc(C)cc1.c1ccc2cc3ccccc3cc2c1.
What is the InChIKey of anthracene;1-ethenyl-4-methylbenzene?
The InChIKey is SVZBLRFPEKYSQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.C9H10/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;1-3-9-6-4-8(2)5-7-9/h1-10H;3-7H,1H2,2H3.
What are the key properties of anthracene;1-ethenyl-4-methylbenzene?
anthracene;1-ethenyl-4-methylbenzene has a molecular weight of 296.41 g/mol, XLogP of 6.63, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene;1-ethenyl-4-methylbenzene is sourced from PubChem (CID 174555561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).