C19H14ClN3 — CID 162700655
2-chloro-4,6-bis(3-ethenylphenyl)-1,3,5-triazine (PubChem CID 162700655) has the molecular formula C19H14ClN3 and a molecular weight of 319.80 g/mol. Its IUPAC name is 2-chloro-4,6-bis(3-ethenylphenyl)-1,3,5-triazine.
| Compound Name | 2-chloro-4,6-bis(3-ethenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 162700655 |
| Molecular Formula | C19H14ClN3 |
| Molecular Weight | 319.80 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 2-chloro-4,6-bis(3-ethenylphenyl)-1,3,5-triazine |
| SMILES | C=Cc1cccc(-c2nc(Cl)nc(-c3cccc(C=C)c3)n2)c1 |
| InChI | InChI=1S/C19H14ClN3/c1-3-13-7-5-9-15(11-13)17-21-18(23-19(20)22-17)16-10-6-8-14(4-2)12-16/h3-12H,1-2H2 |
| InChIKey | JBNXKXFIGPUHSY-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.80 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |