C20H18IrNOSi- — CID 155619291
iridium;trimethyl-(3-phenyl-[1]benzofuro[3,2-c]pyridin-1-yl)silane (PubChem CID 155619291) has the molecular formula C20H18IrNOSi- and a molecular weight of 508.67 g/mol. Its IUPAC name is iridium;trimethyl-(3-phenyl-[1]benzofuro[3,2-c]pyridin-1-yl)silane.
| Compound Name | iridium;trimethyl-(3-phenyl-[1]benzofuro[3,2-c]pyridin-1-yl)silane |
|---|---|
| PubChem CID | 155619291 |
| Molecular Formula | C20H18IrNOSi- |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 509.08 |
| IUPAC Name | iridium;trimethyl-(3-phenyl-[1]benzofuro[3,2-c]pyridin-1-yl)silane |
| SMILES | C[Si](C)(C)c1nc(-c2[c-]cccc2)cc2oc3ccccc3c12.[Ir] |
| InChI | InChI=1S/C20H18NOSi.Ir/c1-23(2,3)20-19-15-11-7-8-12-17(15)22-18(19)13-16(21-20)14-9-5-4-6-10-14;/h4-9,11-13H,1-3H3;/q-1; |
| InChIKey | WFDMZZUNPAEKJK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|