C30H18IrN2OS-2 — CID 176584077
2-(2H-dibenzofuran-2-id-1-yl)-1,3-benzothiazole;iridium;2-phenylpyridine (PubChem CID 176584077) has the molecular formula C30H18IrN2OS-2 and a molecular weight of 646.77 g/mol. Its IUPAC name is 2-(2H-dibenzofuran-2-id-1-yl)-1,3-benzothiazole;iridium;2-phenylpyridine.
| Compound Name | 2-(2H-dibenzofuran-2-id-1-yl)-1,3-benzothiazole;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 176584077 |
| Molecular Formula | C30H18IrN2OS-2 |
| Molecular Weight | 646.77 g/mol |
| Exact Mass | 647.08 |
| IUPAC Name | 2-(2H-dibenzofuran-2-id-1-yl)-1,3-benzothiazole;iridium;2-phenylpyridine |
| SMILES | [Ir].[c-]1ccc2oc3ccccc3c2c1-c1nc2ccccc2s1.[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C19H10NOS.C11H8N.Ir/c1-3-9-15-12(6-1)18-13(7-5-10-16(18)21-15)19-20-14-8-2-4-11-17(14)22-19;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-6,8-11H;1-6,8-9H;/q2*-1; |
| InChIKey | GXUPUVOLUIOKBR-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.77 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|