C23H16IrN3S- — CID 58281788
iridium;2-phenylpyridine;2-pyridin-2-yl-1,3-benzothiazole (PubChem CID 58281788) has the molecular formula C23H16IrN3S- and a molecular weight of 558.69 g/mol. Its IUPAC name is iridium;2-phenylpyridine;2-pyridin-2-yl-1,3-benzothiazole.
| Compound Name | iridium;2-phenylpyridine;2-pyridin-2-yl-1,3-benzothiazole |
|---|---|
| PubChem CID | 58281788 |
| Molecular Formula | C23H16IrN3S- |
| Molecular Weight | 558.69 g/mol |
| Exact Mass | 559.07 |
| IUPAC Name | iridium;2-phenylpyridine;2-pyridin-2-yl-1,3-benzothiazole |
| SMILES | [Ir].[c-]1ccccc1-c1ccccn1.c1ccc(-c2nc3ccccc3s2)nc1 |
| InChI | InChI=1S/C12H8N2S.C11H8N.Ir/c1-2-7-11-9(5-1)14-12(15-11)10-6-3-4-8-13-10;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-8H;1-6,8-9H;/q;-1; |
| InChIKey | MEZQWQQPLJWMGY-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.69 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|