C34H20IrN2S2-2 — CID 164757014
iridium;17-phenyl-16,20-dithia-18-azapentacyclo[12.6.0.02,7.08,13.015,19]icosa-1(14),2,4,6,8,10,12,15(19),17-nonaene;2-phenylpyridine (PubChem CID 164757014) has the molecular formula C34H20IrN2S2-2 and a molecular weight of 712.90 g/mol. Its IUPAC name is iridium;17-phenyl-16,20-dithia-18-azapentacyclo[12.6.0.02,7.08,13.015,19]icosa-1(14),2,4,6,8,10,12,15(19),17-nonaene;2-phenylpyridine.
| Compound Name | iridium;17-phenyl-16,20-dithia-18-azapentacyclo[12.6.0.02,7.08,13.015,19]icosa-1(14),2,4,6,8,10,12,15(19),17-nonaene;2-phenylpyridine |
|---|---|
| PubChem CID | 164757014 |
| Molecular Formula | C34H20IrN2S2-2 |
| Molecular Weight | 712.90 g/mol |
| Exact Mass | 713.07 |
| IUPAC Name | iridium;17-phenyl-16,20-dithia-18-azapentacyclo[12.6.0.02,7.08,13.015,19]icosa-1(14),2,4,6,8,10,12,15(19),17-nonaene;2-phenylpyridine |
| SMILES | [Ir].[c-]1ccccc1-c1ccccn1.[c-]1ccccc1-c1nc2sc3c4ccccc4c4ccccc4c3c2s1 |
| InChI | InChI=1S/C23H12NS2.C11H8N.Ir/c1-2-8-14(9-3-1)22-24-23-21(26-22)19-17-12-6-4-10-15(17)16-11-5-7-13-18(16)20(19)25-23;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-8,10-13H;1-6,8-9H;/q2*-1; |
| InChIKey | RREOFHJJGRKYGY-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.90 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|