C30H20IrN2S-2 — CID 155628605
iridium;2-phenyl-5-phenylthieno[3,2-b]pyridine;2-phenylpyridine (PubChem CID 155628605) has the molecular formula C30H20IrN2S-2 and a molecular weight of 632.79 g/mol. Its IUPAC name is iridium;2-phenyl-5-phenylthieno[3,2-b]pyridine;2-phenylpyridine.
| Compound Name | iridium;2-phenyl-5-phenylthieno[3,2-b]pyridine;2-phenylpyridine |
|---|---|
| PubChem CID | 155628605 |
| Molecular Formula | C30H20IrN2S-2 |
| Molecular Weight | 632.79 g/mol |
| Exact Mass | 633.10 |
| IUPAC Name | iridium;2-phenyl-5-phenylthieno[3,2-b]pyridine;2-phenylpyridine |
| SMILES | [Ir].[c-]1ccccc1-c1ccc2sc(-c3ccccc3)cc2n1.[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C19H12NS.C11H8N.Ir/c1-3-7-14(8-4-1)16-11-12-18-17(20-16)13-19(21-18)15-9-5-2-6-10-15;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-7,9-13H;1-6,8-9H;/q2*-1; |
| InChIKey | NVOZQNQJBMAVHE-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.79 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|