C30H20IrN2Se-2 — CID 155629248
iridium;2-phenyl-6-phenylselenopheno[2,3-b]pyridine;2-phenylpyridine (PubChem CID 155629248) has the molecular formula C30H20IrN2Se-2 and a molecular weight of 679.68 g/mol. Its IUPAC name is iridium;2-phenyl-6-phenylselenopheno[2,3-b]pyridine;2-phenylpyridine.
| Compound Name | iridium;2-phenyl-6-phenylselenopheno[2,3-b]pyridine;2-phenylpyridine |
|---|---|
| PubChem CID | 155629248 |
| Molecular Formula | C30H20IrN2Se-2 |
| Molecular Weight | 679.68 g/mol |
| Exact Mass | 681.04 |
| IUPAC Name | iridium;2-phenyl-6-phenylselenopheno[2,3-b]pyridine;2-phenylpyridine |
| SMILES | [Ir].[c-]1ccccc1-c1ccc2cc(-c3ccccc3)[se]c2n1.[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C19H12NSe.C11H8N.Ir/c1-3-7-14(8-4-1)17-12-11-16-13-18(21-19(16)20-17)15-9-5-2-6-10-15;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-7,9-13H;1-6,8-9H;/q2*-1; |
| InChIKey | PGFOMYOFNMVBML-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.68 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|