About carbanide;2-phenylquinoline;platinum
carbanide;2-phenylquinoline;platinum (PubChem CID 21044184) has the molecular formula C17H16NPt-3
and a molecular weight of 429.40 g/mol. Its IUPAC name is carbanide;2-phenylquinoline;platinum.
Molecular Properties
| Compound Name | carbanide;2-phenylquinoline;platinum |
| PubChem CID | 21044184 |
| Molecular Formula | C17H16NPt-3 |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | carbanide;2-phenylquinoline;platinum |
| SMILES | [CH3-].[CH3-].[Pt].[c-]1ccccc1-c1ccc2ccccc2n1 |
| InChI | InChI=1S/C15H10N.2CH3.Pt/c1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)16-15;;;/h1-6,8-11H;2*1H3;/q3*-1; |
| InChIKey | DYCLNSJFPOHTIA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;2-phenylquinoline;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;2-phenylquinoline;platinum?
The IUPAC name of carbanide;2-phenylquinoline;platinum (CID 21044184) is carbanide;2-phenylquinoline;platinum.
What is the SMILES notation for carbanide;2-phenylquinoline;platinum?
The canonical SMILES for carbanide;2-phenylquinoline;platinum is [CH3-].[CH3-].[Pt].[c-]1ccccc1-c1ccc2ccccc2n1.
What is the InChIKey of carbanide;2-phenylquinoline;platinum?
The InChIKey is DYCLNSJFPOHTIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N.2CH3.Pt/c1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)16-15;;;/h1-6,8-11H;2*1H3;/q3*-1;.
What are the key properties of carbanide;2-phenylquinoline;platinum?
carbanide;2-phenylquinoline;platinum has a molecular weight of 429.40 g/mol, XLogP of 4.60, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;2-phenylquinoline;platinum is sourced from PubChem (CID 21044184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).