C25H24IrNO2- — CID 170528108
8-hydroxy-3,4,4a,5,6,7-hexahydro-2H-naphthalen-1-one;iridium;2-phenylquinoline (PubChem CID 170528108) has the molecular formula C25H24IrNO2- and a molecular weight of 562.69 g/mol. Its IUPAC name is 8-hydroxy-3,4,4a,5,6,7-hexahydro-2H-naphthalen-1-one;iridium;2-phenylquinoline.
| Compound Name | 8-hydroxy-3,4,4a,5,6,7-hexahydro-2H-naphthalen-1-one;iridium;2-phenylquinoline |
|---|---|
| PubChem CID | 170528108 |
| Molecular Formula | C25H24IrNO2- |
| Molecular Weight | 562.69 g/mol |
| Exact Mass | 563.14 |
| IUPAC Name | 8-hydroxy-3,4,4a,5,6,7-hexahydro-2H-naphthalen-1-one;iridium;2-phenylquinoline |
| SMILES | O=C1CCCC2CCCC(O)=C12.[Ir].[c-]1ccccc1-c1ccc2ccccc2n1 |
| InChI | InChI=1S/C15H10N.C10H14O2.Ir/c1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)16-15;11-8-5-1-3-7-4-2-6-9(12)10(7)8;/h1-6,8-11H;7,11H,1-6H2;/q-1;; |
| InChIKey | NUXSGFAGMMYMKT-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.69 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|