C26H26IrNO2- — CID 170527410
8-hydroxy-3,4,4a,5,6,7-hexahydro-2H-naphthalen-1-one;iridium;4-methyl-2-phenylquinoline (PubChem CID 170527410) has the molecular formula C26H26IrNO2- and a molecular weight of 576.72 g/mol. Its IUPAC name is 8-hydroxy-3,4,4a,5,6,7-hexahydro-2H-naphthalen-1-one;iridium;4-methyl-2-phenylquinoline.
| Compound Name | 8-hydroxy-3,4,4a,5,6,7-hexahydro-2H-naphthalen-1-one;iridium;4-methyl-2-phenylquinoline |
|---|---|
| PubChem CID | 170527410 |
| Molecular Formula | C26H26IrNO2- |
| Molecular Weight | 576.72 g/mol |
| Exact Mass | 577.16 |
| IUPAC Name | 8-hydroxy-3,4,4a,5,6,7-hexahydro-2H-naphthalen-1-one;iridium;4-methyl-2-phenylquinoline |
| SMILES | Cc1cc(-c2[c-]cccc2)nc2ccccc12.O=C1CCCC2CCCC(O)=C12.[Ir] |
| InChI | InChI=1S/C16H12N.C10H14O2.Ir/c1-12-11-16(13-7-3-2-4-8-13)17-15-10-6-5-9-14(12)15;11-8-5-1-3-7-4-2-6-9(12)10(7)8;/h2-7,9-11H,1H3;7,11H,1-6H2;/q-1;; |
| InChIKey | FTKUGEGXBBKVQR-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.72 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|