C30H34IrNO2- — CID 170527379
8-hydroxy-2,2,7,7-tetramethyl-4,4a,5,6-tetrahydro-3H-naphthalen-1-one;iridium;6-methyl-2-phenylquinoline (PubChem CID 170527379) has the molecular formula C30H34IrNO2- and a molecular weight of 632.82 g/mol. Its IUPAC name is 8-hydroxy-2,2,7,7-tetramethyl-4,4a,5,6-tetrahydro-3H-naphthalen-1-one;iridium;6-methyl-2-phenylquinoline.
| Compound Name | 8-hydroxy-2,2,7,7-tetramethyl-4,4a,5,6-tetrahydro-3H-naphthalen-1-one;iridium;6-methyl-2-phenylquinoline |
|---|---|
| PubChem CID | 170527379 |
| Molecular Formula | C30H34IrNO2- |
| Molecular Weight | 632.82 g/mol |
| Exact Mass | 633.22 |
| IUPAC Name | 8-hydroxy-2,2,7,7-tetramethyl-4,4a,5,6-tetrahydro-3H-naphthalen-1-one;iridium;6-methyl-2-phenylquinoline |
| SMILES | CC1(C)CCC2CCC(C)(C)C(O)=C2C1=O.Cc1ccc2nc(-c3[c-]cccc3)ccc2c1.[Ir] |
| InChI | InChI=1S/C16H12N.C14H22O2.Ir/c1-12-7-9-16-14(11-12)8-10-15(17-16)13-5-3-2-4-6-13;1-13(2)7-5-9-6-8-14(3,4)12(16)10(9)11(13)15;/h2-5,7-11H,1H3;9,15H,5-8H2,1-4H3;/q-1;; |
| InChIKey | WHAWPKGMKMJVEX-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.82 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|