C33H40IrNO2- — CID 170528603
7-tert-butyl-3-phenylisoquinoline;8-hydroxy-2,2,7,7-tetramethyl-4,4a,5,6-tetrahydro-3H-naphthalen-1-one;iridium (PubChem CID 170528603) has the molecular formula C33H40IrNO2- and a molecular weight of 674.91 g/mol. Its IUPAC name is 7-tert-butyl-3-phenylisoquinoline;8-hydroxy-2,2,7,7-tetramethyl-4,4a,5,6-tetrahydro-3H-naphthalen-1-one;iridium.
| Compound Name | 7-tert-butyl-3-phenylisoquinoline;8-hydroxy-2,2,7,7-tetramethyl-4,4a,5,6-tetrahydro-3H-naphthalen-1-one;iridium |
|---|---|
| PubChem CID | 170528603 |
| Molecular Formula | C33H40IrNO2- |
| Molecular Weight | 674.91 g/mol |
| Exact Mass | 675.27 |
| IUPAC Name | 7-tert-butyl-3-phenylisoquinoline;8-hydroxy-2,2,7,7-tetramethyl-4,4a,5,6-tetrahydro-3H-naphthalen-1-one;iridium |
| SMILES | CC(C)(C)c1ccc2cc(-c3[c-]cccc3)ncc2c1.CC1(C)CCC2CCC(C)(C)C(O)=C2C1=O.[Ir] |
| InChI | InChI=1S/C19H18N.C14H22O2.Ir/c1-19(2,3)17-10-9-15-12-18(20-13-16(15)11-17)14-7-5-4-6-8-14;1-13(2)7-5-9-6-8-14(3,4)12(16)10(9)11(13)15;/h4-7,9-13H,1-3H3;9,15H,5-8H2,1-4H3;/q-1;; |
| InChIKey | FOIIJGTUJNMRRR-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.91 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|