C25H21ClIrN3- — CID 58280757
4-(4-tert-butylphenyl)-2-chloro-6-(6-phenyl-3-pyridinyl)pyrimidine;iridium (PubChem CID 58280757) has the molecular formula C25H21ClIrN3- and a molecular weight of 591.13 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)-2-chloro-6-(6-phenyl-3-pyridinyl)pyrimidine;iridium.
| Compound Name | 4-(4-tert-butylphenyl)-2-chloro-6-(6-phenyl-3-pyridinyl)pyrimidine;iridium |
|---|---|
| PubChem CID | 58280757 |
| Molecular Formula | C25H21ClIrN3- |
| Molecular Weight | 591.13 g/mol |
| Exact Mass | 591.11 |
| IUPAC Name | 4-(4-tert-butylphenyl)-2-chloro-6-(6-phenyl-3-pyridinyl)pyrimidine;iridium |
| SMILES | CC(C)(C)c1ccc(-c2cc(-c3ccc(-c4[c-]cccc4)nc3)nc(Cl)n2)cc1.[Ir] |
| InChI | InChI=1S/C25H21ClN3.Ir/c1-25(2,3)20-12-9-18(10-13-20)22-15-23(29-24(26)28-22)19-11-14-21(27-16-19)17-7-5-4-6-8-17;/h4-7,9-16H,1-3H3;/q-1; |
| InChIKey | KSNLJMMYAGMNLC-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.13 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|