C19H18IrN3- — CID 58261681
5-tert-butyl-2-(6-phenyl-3-pyridinyl)pyrimidine;iridium (PubChem CID 58261681) has the molecular formula C19H18IrN3- and a molecular weight of 480.59 g/mol. Its IUPAC name is 5-tert-butyl-2-(6-phenyl-3-pyridinyl)pyrimidine;iridium.
| Compound Name | 5-tert-butyl-2-(6-phenyl-3-pyridinyl)pyrimidine;iridium |
|---|---|
| PubChem CID | 58261681 |
| Molecular Formula | C19H18IrN3- |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | 5-tert-butyl-2-(6-phenyl-3-pyridinyl)pyrimidine;iridium |
| SMILES | CC(C)(C)c1cnc(-c2ccc(-c3[c-]cccc3)nc2)nc1.[Ir] |
| InChI | InChI=1S/C19H18N3.Ir/c1-19(2,3)16-12-21-18(22-13-16)15-9-10-17(20-11-15)14-7-5-4-6-8-14;/h4-7,9-13H,1-3H3;/q-1; |
| InChIKey | RPGQIGGMHJQZGI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|