C36H46IrNO2- — CID 170527633
iridium;1-phenyl-4-propan-2-ylisoquinoline;2,2,7,7-tetraethyl-8-hydroxy-4,4a,5,6-tetrahydro-3H-naphthalen-1-one (PubChem CID 170527633) has the molecular formula C36H46IrNO2- and a molecular weight of 716.99 g/mol. Its IUPAC name is iridium;1-phenyl-4-propan-2-ylisoquinoline;2,2,7,7-tetraethyl-8-hydroxy-4,4a,5,6-tetrahydro-3H-naphthalen-1-one.
| Compound Name | iridium;1-phenyl-4-propan-2-ylisoquinoline;2,2,7,7-tetraethyl-8-hydroxy-4,4a,5,6-tetrahydro-3H-naphthalen-1-one |
|---|---|
| PubChem CID | 170527633 |
| Molecular Formula | C36H46IrNO2- |
| Molecular Weight | 716.99 g/mol |
| Exact Mass | 717.32 |
| IUPAC Name | iridium;1-phenyl-4-propan-2-ylisoquinoline;2,2,7,7-tetraethyl-8-hydroxy-4,4a,5,6-tetrahydro-3H-naphthalen-1-one |
| SMILES | CC(C)c1cnc(-c2[c-]cccc2)c2ccccc12.CCC1(CC)CCC2CCC(CC)(CC)C(O)=C2C1=O.[Ir] |
| InChI | InChI=1S/C18H16N.C18H30O2.Ir/c1-13(2)17-12-19-18(14-8-4-3-5-9-14)16-11-7-6-10-15(16)17;1-5-17(6-2)11-9-13-10-12-18(7-3,8-4)16(20)14(13)15(17)19;/h3-8,10-13H,1-2H3;13,19H,5-12H2,1-4H3;/q-1;; |
| InChIKey | WNOLIFNJCDWAGF-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.99 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|