C31H38IrNO3- — CID 170527910
iridium;2-phenyl-1,3-benzoxazole;2,2,7,7-tetraethyl-8-hydroxy-4,4a,5,6-tetrahydro-3H-naphthalen-1-one (PubChem CID 170527910) has the molecular formula C31H38IrNO3- and a molecular weight of 664.87 g/mol. Its IUPAC name is iridium;2-phenyl-1,3-benzoxazole;2,2,7,7-tetraethyl-8-hydroxy-4,4a,5,6-tetrahydro-3H-naphthalen-1-one.
| Compound Name | iridium;2-phenyl-1,3-benzoxazole;2,2,7,7-tetraethyl-8-hydroxy-4,4a,5,6-tetrahydro-3H-naphthalen-1-one |
|---|---|
| PubChem CID | 170527910 |
| Molecular Formula | C31H38IrNO3- |
| Molecular Weight | 664.87 g/mol |
| Exact Mass | 665.25 |
| IUPAC Name | iridium;2-phenyl-1,3-benzoxazole;2,2,7,7-tetraethyl-8-hydroxy-4,4a,5,6-tetrahydro-3H-naphthalen-1-one |
| SMILES | CCC1(CC)CCC2CCC(CC)(CC)C(O)=C2C1=O.[Ir].[c-]1ccccc1-c1nc2ccccc2o1 |
| InChI | InChI=1S/C18H30O2.C13H8NO.Ir/c1-5-17(6-2)11-9-13-10-12-18(7-3,8-4)16(20)14(13)15(17)19;1-2-6-10(7-3-1)13-14-11-8-4-5-9-12(11)15-13;/h13,19H,5-12H2,1-4H3;1-6,8-9H;/q;-1; |
| InChIKey | SSZXZBDCKYPFHN-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.87 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|