C13H9NO2 — CID 19427209
2-(1,3-benzoxazol-2-yl)cyclohexa-2,4-dien-1-one (PubChem CID 19427209) has the molecular formula C13H9NO2 and a molecular weight of 211.22 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-yl)cyclohexa-2,4-dien-1-one.
| Compound Name | 2-(1,3-benzoxazol-2-yl)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 19427209 |
| Molecular Formula | C13H9NO2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 2-(1,3-benzoxazol-2-yl)cyclohexa-2,4-dien-1-one |
| SMILES | O=C1CC=CC=C1c1nc2ccccc2o1 |
| InChI | InChI=1S/C13H9NO2/c15-11-7-3-1-5-9(11)13-14-10-6-2-4-8-12(10)16-13/h1-6,8H,7H2 |
| InChIKey | PEELZSXQBYWPPX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |