C15H13NO — CID 142275370
2-(4-methylcyclohepta-1,3,6-trien-1-yl)-1,3-benzoxazole (PubChem CID 142275370) has the molecular formula C15H13NO and a molecular weight of 223.28 g/mol. Its IUPAC name is 2-(4-methylcyclohepta-1,3,6-trien-1-yl)-1,3-benzoxazole.
| Compound Name | 2-(4-methylcyclohepta-1,3,6-trien-1-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 142275370 |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 2-(4-methylcyclohepta-1,3,6-trien-1-yl)-1,3-benzoxazole |
| SMILES | CC1=CC=C(c2nc3ccccc3o2)C=CC1 |
| InChI | InChI=1S/C15H13NO/c1-11-5-4-6-12(10-9-11)15-16-13-7-2-3-8-14(13)17-15/h2-4,6-10H,5H2,1H3 |
| InChIKey | BDDDCBBGQKUWOX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |