1-(1,3-benzoxazol-2-yl)-4-ethylpiperidine-2-carboxylic acid

C15H18N2O3 — CID 114427658

IUPAC1-(1,3-benzoxazol-2-yl)-4-ethylpiperidine-2-carboxylic acid
SMILESCCC1CCN(c2nc3ccccc3o2)C(C(=O)O)C1
InChIInChI=1S/C15H18N2O3/c1-2-10-7-8-17(12(9-10)14(18)19)15-16-11-5-3-4-6-13(11)20-15/h3-6,10,12H,2,7-9H2,1H3,(H,18,19)
InChIKeyDNNCVVDHEYRBPS-UHFFFAOYSA-N
MW274.32 g/mol
LogP2.91
Rot. Bonds3

About 1-(1,3-benzoxazol-2-yl)-4-ethylpiperidine-2-carboxylic acid

1-(1,3-benzoxazol-2-yl)-4-ethylpiperidine-2-carboxylic acid (PubChem CID 114427658) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-2-yl)-4-ethylpiperidine-2-carboxylic acid.

Molecular Properties

Compound Name1-(1,3-benzoxazol-2-yl)-4-ethylpiperidine-2-carboxylic acid
PubChem CID114427658
Molecular FormulaC15H18N2O3
Molecular Weight274.32 g/mol
Exact Mass274.13
IUPAC Name1-(1,3-benzoxazol-2-yl)-4-ethylpiperidine-2-carboxylic acid
SMILESCCC1CCN(c2nc3ccccc3o2)C(C(=O)O)C1
InChIInChI=1S/C15H18N2O3/c1-2-10-7-8-17(12(9-10)14(18)19)15-16-11-5-3-4-6-13(11)20-15/h3-6,10,12H,2,7-9H2,1H3,(H,18,19)
InChIKeyDNNCVVDHEYRBPS-UHFFFAOYSA-N
XLogP2.91
TPSA66.57 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.32
LogP ≤ 52.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1-(1,3-benzoxazol-2-yl)-4-ethylpiperidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(1,3-benzoxazol-2-yl)-4-ethylpiperidine-2-carboxylic acid?
The IUPAC name of 1-(1,3-benzoxazol-2-yl)-4-ethylpiperidine-2-carboxylic acid (CID 114427658) is 1-(1,3-benzoxazol-2-yl)-4-ethylpiperidine-2-carboxylic acid.
What is the SMILES notation for 1-(1,3-benzoxazol-2-yl)-4-ethylpiperidine-2-carboxylic acid?
The canonical SMILES for 1-(1,3-benzoxazol-2-yl)-4-ethylpiperidine-2-carboxylic acid is CCC1CCN(c2nc3ccccc3o2)C(C(=O)O)C1.
What is the InChIKey of 1-(1,3-benzoxazol-2-yl)-4-ethylpiperidine-2-carboxylic acid?
The InChIKey is DNNCVVDHEYRBPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O3/c1-2-10-7-8-17(12(9-10)14(18)19)15-16-11-5-3-4-6-13(11)20-15/h3-6,10,12H,2,7-9H2,1H3,(H,18,19).
What are the key properties of 1-(1,3-benzoxazol-2-yl)-4-ethylpiperidine-2-carboxylic acid?
1-(1,3-benzoxazol-2-yl)-4-ethylpiperidine-2-carboxylic acid has a molecular weight of 274.32 g/mol, XLogP of 2.91, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-benzoxazol-2-yl)-4-ethylpiperidine-2-carboxylic acid is sourced from PubChem (CID 114427658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).