(2R)-1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylic acid

C12H12N2O3 — CID 93429227

IUPAC(2R)-1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylic acid
SMILESO=C(O)[C@H]1CCCN1c1nc2ccccc2o1
InChIInChI=1S/C12H12N2O3/c15-11(16)9-5-3-7-14(9)12-13-8-4-1-2-6-10(8)17-12/h1-2,4,6,9H,3,5,7H2,(H,15,16)/t9-/m1/s1
InChIKeyXZDROSVGWGPGLE-SECBINFHSA-N
MW232.24 g/mol
LogP1.88
Rot. Bonds2

About (2R)-1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylic acid

(2R)-1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylic acid (PubChem CID 93429227) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is (2R)-1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylic acid.

Molecular Properties

Compound Name(2R)-1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylic acid
PubChem CID93429227
Molecular FormulaC12H12N2O3
Molecular Weight232.24 g/mol
Exact Mass232.08
IUPAC Name(2R)-1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylic acid
SMILESO=C(O)[C@H]1CCCN1c1nc2ccccc2o1
InChIInChI=1S/C12H12N2O3/c15-11(16)9-5-3-7-14(9)12-13-8-4-1-2-6-10(8)17-12/h1-2,4,6,9H,3,5,7H2,(H,15,16)/t9-/m1/s1
InChIKeyXZDROSVGWGPGLE-SECBINFHSA-N
XLogP1.88
TPSA66.57 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.24
LogP ≤ 51.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze (2R)-1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylic acid?
The IUPAC name of (2R)-1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylic acid (CID 93429227) is (2R)-1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylic acid.
What is the SMILES notation for (2R)-1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylic acid?
The canonical SMILES for (2R)-1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylic acid is O=C(O)[C@H]1CCCN1c1nc2ccccc2o1.
What is the InChIKey of (2R)-1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylic acid?
The InChIKey is XZDROSVGWGPGLE-SECBINFHSA-N. The full InChI is InChI=1S/C12H12N2O3/c15-11(16)9-5-3-7-14(9)12-13-8-4-1-2-6-10(8)17-12/h1-2,4,6,9H,3,5,7H2,(H,15,16)/t9-/m1/s1.
What are the key properties of (2R)-1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylic acid?
(2R)-1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylic acid has a molecular weight of 232.24 g/mol, XLogP of 1.88, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 93429227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).