propan-2-yl 1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylate

C15H18N2O3 — CID 23397364

IUPACpropan-2-yl 1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylate
SMILESCC(C)OC(=O)C1CCCN1c1nc2ccccc2o1
InChIInChI=1S/C15H18N2O3/c1-10(2)19-14(18)12-7-5-9-17(12)15-16-11-6-3-4-8-13(11)20-15/h3-4,6,8,10,12H,5,7,9H2,1-2H3
InChIKeyQTHGBZYWMQOLJL-UHFFFAOYSA-N
MW274.32 g/mol
LogP2.75
Rot. Bonds3

About propan-2-yl 1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylate

propan-2-yl 1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylate (PubChem CID 23397364) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is propan-2-yl 1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylate.

Molecular Properties

Compound Namepropan-2-yl 1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylate
PubChem CID23397364
Molecular FormulaC15H18N2O3
Molecular Weight274.32 g/mol
Exact Mass274.13
IUPAC Namepropan-2-yl 1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylate
SMILESCC(C)OC(=O)C1CCCN1c1nc2ccccc2o1
InChIInChI=1S/C15H18N2O3/c1-10(2)19-14(18)12-7-5-9-17(12)15-16-11-6-3-4-8-13(11)20-15/h3-4,6,8,10,12H,5,7,9H2,1-2H3
InChIKeyQTHGBZYWMQOLJL-UHFFFAOYSA-N
XLogP2.75
TPSA55.57 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.32
LogP ≤ 52.75
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze propan-2-yl 1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of propan-2-yl 1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylate?
The IUPAC name of propan-2-yl 1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylate (CID 23397364) is propan-2-yl 1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylate.
What is the SMILES notation for propan-2-yl 1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylate?
The canonical SMILES for propan-2-yl 1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylate is CC(C)OC(=O)C1CCCN1c1nc2ccccc2o1.
What is the InChIKey of propan-2-yl 1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylate?
The InChIKey is QTHGBZYWMQOLJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O3/c1-10(2)19-14(18)12-7-5-9-17(12)15-16-11-6-3-4-8-13(11)20-15/h3-4,6,8,10,12H,5,7,9H2,1-2H3.
What are the key properties of propan-2-yl 1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylate?
propan-2-yl 1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylate has a molecular weight of 274.32 g/mol, XLogP of 2.75, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carboxylate is sourced from PubChem (CID 23397364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).