C19H23N3O6 — CID 99903586
diethyl 2-[[(2R)-1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carbonyl]amino]propanedioate (PubChem CID 99903586) has the molecular formula C19H23N3O6 and a molecular weight of 389.41 g/mol. Its IUPAC name is diethyl 2-[[(2R)-1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carbonyl]amino]propanedioate.
| Compound Name | diethyl 2-[[(2R)-1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carbonyl]amino]propanedioate |
|---|---|
| PubChem CID | 99903586 |
| Molecular Formula | C19H23N3O6 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | diethyl 2-[[(2R)-1-(1,3-benzoxazol-2-yl)pyrrolidine-2-carbonyl]amino]propanedioate |
| SMILES | CCOC(=O)C(NC(=O)[C@H]1CCCN1c1nc2ccccc2o1)C(=O)OCC |
| InChI | InChI=1S/C19H23N3O6/c1-3-26-17(24)15(18(25)27-4-2)21-16(23)13-9-7-11-22(13)19-20-12-8-5-6-10-14(12)28-19/h5-6,8,10,13,15H,3-4,7,9,11H2,1-2H3,(H,21,23)/t13-/m1/s1 |
| InChIKey | QQNKBJJNNNAJJF-CYBMUJFWSA-N |
| XLogP | 1.41 |
| TPSA | 110.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|