(2R)-1-(1,3-benzoxazol-2-yl)piperazine-2-carboxylic acid

C12H13N3O3 — CID 97055425

IUPAC(2R)-1-(1,3-benzoxazol-2-yl)piperazine-2-carboxylic acid
SMILESO=C(O)[C@H]1CNCCN1c1nc2ccccc2o1
InChIInChI=1S/C12H13N3O3/c16-11(17)9-7-13-5-6-15(9)12-14-8-3-1-2-4-10(8)18-12/h1-4,9,13H,5-7H2,(H,16,17)/t9-/m1/s1
InChIKeyIAULTTJACOMJLQ-SECBINFHSA-N
MW247.25 g/mol
LogP0.69
Rot. Bonds2

About (2R)-1-(1,3-benzoxazol-2-yl)piperazine-2-carboxylic acid

(2R)-1-(1,3-benzoxazol-2-yl)piperazine-2-carboxylic acid (PubChem CID 97055425) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is (2R)-1-(1,3-benzoxazol-2-yl)piperazine-2-carboxylic acid.

Molecular Properties

Compound Name(2R)-1-(1,3-benzoxazol-2-yl)piperazine-2-carboxylic acid
PubChem CID97055425
Molecular FormulaC12H13N3O3
Molecular Weight247.25 g/mol
Exact Mass247.10
IUPAC Name(2R)-1-(1,3-benzoxazol-2-yl)piperazine-2-carboxylic acid
SMILESO=C(O)[C@H]1CNCCN1c1nc2ccccc2o1
InChIInChI=1S/C12H13N3O3/c16-11(17)9-7-13-5-6-15(9)12-14-8-3-1-2-4-10(8)18-12/h1-4,9,13H,5-7H2,(H,16,17)/t9-/m1/s1
InChIKeyIAULTTJACOMJLQ-SECBINFHSA-N
XLogP0.69
TPSA78.60 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.25
LogP ≤ 50.69
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze (2R)-1-(1,3-benzoxazol-2-yl)piperazine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-1-(1,3-benzoxazol-2-yl)piperazine-2-carboxylic acid?
The IUPAC name of (2R)-1-(1,3-benzoxazol-2-yl)piperazine-2-carboxylic acid (CID 97055425) is (2R)-1-(1,3-benzoxazol-2-yl)piperazine-2-carboxylic acid.
What is the SMILES notation for (2R)-1-(1,3-benzoxazol-2-yl)piperazine-2-carboxylic acid?
The canonical SMILES for (2R)-1-(1,3-benzoxazol-2-yl)piperazine-2-carboxylic acid is O=C(O)[C@H]1CNCCN1c1nc2ccccc2o1.
What is the InChIKey of (2R)-1-(1,3-benzoxazol-2-yl)piperazine-2-carboxylic acid?
The InChIKey is IAULTTJACOMJLQ-SECBINFHSA-N. The full InChI is InChI=1S/C12H13N3O3/c16-11(17)9-7-13-5-6-15(9)12-14-8-3-1-2-4-10(8)18-12/h1-4,9,13H,5-7H2,(H,16,17)/t9-/m1/s1.
What are the key properties of (2R)-1-(1,3-benzoxazol-2-yl)piperazine-2-carboxylic acid?
(2R)-1-(1,3-benzoxazol-2-yl)piperazine-2-carboxylic acid has a molecular weight of 247.25 g/mol, XLogP of 0.69, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-(1,3-benzoxazol-2-yl)piperazine-2-carboxylic acid is sourced from PubChem (CID 97055425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).