C32H38IrNO2- — CID 170528260
2,2-diethyl-8-hydroxy-7,7-dimethyl-4,4a,5,6-tetrahydro-3H-naphthalen-1-one;iridium;7-methyl-3-phenylisoquinoline (PubChem CID 170528260) has the molecular formula C32H38IrNO2- and a molecular weight of 660.88 g/mol. Its IUPAC name is 2,2-diethyl-8-hydroxy-7,7-dimethyl-4,4a,5,6-tetrahydro-3H-naphthalen-1-one;iridium;7-methyl-3-phenylisoquinoline.
| Compound Name | 2,2-diethyl-8-hydroxy-7,7-dimethyl-4,4a,5,6-tetrahydro-3H-naphthalen-1-one;iridium;7-methyl-3-phenylisoquinoline |
|---|---|
| PubChem CID | 170528260 |
| Molecular Formula | C32H38IrNO2- |
| Molecular Weight | 660.88 g/mol |
| Exact Mass | 661.25 |
| IUPAC Name | 2,2-diethyl-8-hydroxy-7,7-dimethyl-4,4a,5,6-tetrahydro-3H-naphthalen-1-one;iridium;7-methyl-3-phenylisoquinoline |
| SMILES | CCC1(CC)CCC2CCC(C)(C)C(O)=C2C1=O.Cc1ccc2cc(-c3[c-]cccc3)ncc2c1.[Ir] |
| InChI | InChI=1S/C16H12N.C16H26O2.Ir/c1-12-7-8-14-10-16(17-11-15(14)9-12)13-5-3-2-4-6-13;1-5-16(6-2)10-8-11-7-9-15(3,4)13(17)12(11)14(16)18;/h2-5,7-11H,1H3;11,17H,5-10H2,1-4H3;/q-1;; |
| InChIKey | IMLNBYITTMCDJK-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.88 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|