C32H42IrNO2- — CID 170527256
(2R)-2,7-di(propan-2-yl)-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1,8-diol;iridium;6-methyl-3-phenylisoquinoline (PubChem CID 170527256) has the molecular formula C32H42IrNO2- and a molecular weight of 664.91 g/mol. Its IUPAC name is (2R)-2,7-di(propan-2-yl)-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1,8-diol;iridium;6-methyl-3-phenylisoquinoline.
| Compound Name | (2R)-2,7-di(propan-2-yl)-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1,8-diol;iridium;6-methyl-3-phenylisoquinoline |
|---|---|
| PubChem CID | 170527256 |
| Molecular Formula | C32H42IrNO2- |
| Molecular Weight | 664.91 g/mol |
| Exact Mass | 665.29 |
| IUPAC Name | (2R)-2,7-di(propan-2-yl)-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1,8-diol;iridium;6-methyl-3-phenylisoquinoline |
| SMILES | CC(C)C1CCCC2C[C@H](C(C)C)C(O)C2C1O.Cc1ccc2cnc(-c3[c-]cccc3)cc2c1.[Ir] |
| InChI | InChI=1S/C16H12N.C16H30O2.Ir/c1-12-7-8-14-11-17-16(10-15(14)9-12)13-5-3-2-4-6-13;1-9(2)12-7-5-6-11-8-13(10(3)4)16(18)14(11)15(12)17;/h2-5,7-11H,1H3;9-18H,5-8H2,1-4H3;/q-1;;/t;11?,12?,13-,14?,15?,16?;/m.1./s1 |
| InChIKey | MGPWOFQNJSWQMN-XWDXSQSBSA-N |
| XLogP | 7.08 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.91 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|