C35H48IrNO2- — CID 170527334
iridium;8-methyl-3-phenylisoquinoline;3,3,6,6-tetraethyl-2,4,4a,5,7,8,9,9a-octahydro-1H-benzo[7]annulene-4,5-diol (PubChem CID 170527334) has the molecular formula C35H48IrNO2- and a molecular weight of 706.99 g/mol. Its IUPAC name is iridium;8-methyl-3-phenylisoquinoline;3,3,6,6-tetraethyl-2,4,4a,5,7,8,9,9a-octahydro-1H-benzo[7]annulene-4,5-diol.
| Compound Name | iridium;8-methyl-3-phenylisoquinoline;3,3,6,6-tetraethyl-2,4,4a,5,7,8,9,9a-octahydro-1H-benzo[7]annulene-4,5-diol |
|---|---|
| PubChem CID | 170527334 |
| Molecular Formula | C35H48IrNO2- |
| Molecular Weight | 706.99 g/mol |
| Exact Mass | 707.33 |
| IUPAC Name | iridium;8-methyl-3-phenylisoquinoline;3,3,6,6-tetraethyl-2,4,4a,5,7,8,9,9a-octahydro-1H-benzo[7]annulene-4,5-diol |
| SMILES | CCC1(CC)CCCC2CCC(CC)(CC)C(O)C2C1O.Cc1cccc2cc(-c3[c-]cccc3)ncc12.[Ir] |
| InChI | InChI=1S/C19H36O2.C16H12N.Ir/c1-5-18(6-2)12-9-10-14-11-13-19(7-3,8-4)17(21)15(14)16(18)20;1-12-6-5-9-14-10-16(17-11-15(12)14)13-7-3-2-4-8-13;/h14-17,20-21H,5-13H2,1-4H3;2-7,9-11H,1H3;/q;-1; |
| InChIKey | VCJCDZWCINBGMQ-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.99 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|