C36H50IrNO2- — CID 170528001
iridium;5-methyl-1-phenylisoquinoline;2,2,9,9-tetraethyl-1,3,4,5,5a,6,7,8,10,10a-decahydroheptalene-1,10-diol (PubChem CID 170528001) has the molecular formula C36H50IrNO2- and a molecular weight of 721.02 g/mol. Its IUPAC name is iridium;5-methyl-1-phenylisoquinoline;2,2,9,9-tetraethyl-1,3,4,5,5a,6,7,8,10,10a-decahydroheptalene-1,10-diol.
| Compound Name | iridium;5-methyl-1-phenylisoquinoline;2,2,9,9-tetraethyl-1,3,4,5,5a,6,7,8,10,10a-decahydroheptalene-1,10-diol |
|---|---|
| PubChem CID | 170528001 |
| Molecular Formula | C36H50IrNO2- |
| Molecular Weight | 721.02 g/mol |
| Exact Mass | 721.35 |
| IUPAC Name | iridium;5-methyl-1-phenylisoquinoline;2,2,9,9-tetraethyl-1,3,4,5,5a,6,7,8,10,10a-decahydroheptalene-1,10-diol |
| SMILES | CCC1(CC)CCCC2CCCC(CC)(CC)C(O)C2C1O.Cc1cccc2c(-c3[c-]cccc3)nccc12.[Ir] |
| InChI | InChI=1S/C20H38O2.C16H12N.Ir/c1-5-19(6-2)13-9-11-15-12-10-14-20(7-3,8-4)18(22)16(15)17(19)21;1-12-6-5-9-15-14(12)10-11-17-16(15)13-7-3-2-4-8-13;/h15-18,21-22H,5-14H2,1-4H3;2-7,9-11H,1H3;/q;-1; |
| InChIKey | LJBGUEYRVOEEAD-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.02 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|