C34H46IrNO2- — CID 170527810
1-(3,5-dimethylbenzene-6-id-1-yl)isoquinoline;iridium;2,2,6,6-tetraethyl-3,3a,4,5,7,7a-hexahydro-1H-indene-1,7-diol (PubChem CID 170527810) has the molecular formula C34H46IrNO2- and a molecular weight of 692.96 g/mol. Its IUPAC name is 1-(3,5-dimethylbenzene-6-id-1-yl)isoquinoline;iridium;2,2,6,6-tetraethyl-3,3a,4,5,7,7a-hexahydro-1H-indene-1,7-diol.
| Compound Name | 1-(3,5-dimethylbenzene-6-id-1-yl)isoquinoline;iridium;2,2,6,6-tetraethyl-3,3a,4,5,7,7a-hexahydro-1H-indene-1,7-diol |
|---|---|
| PubChem CID | 170527810 |
| Molecular Formula | C34H46IrNO2- |
| Molecular Weight | 692.96 g/mol |
| Exact Mass | 693.32 |
| IUPAC Name | 1-(3,5-dimethylbenzene-6-id-1-yl)isoquinoline;iridium;2,2,6,6-tetraethyl-3,3a,4,5,7,7a-hexahydro-1H-indene-1,7-diol |
| SMILES | CCC1(CC)CCC2CC(CC)(CC)C(O)C2C1O.Cc1[c-]c(-c2nccc3ccccc23)cc(C)c1.[Ir] |
| InChI | InChI=1S/C17H14N.C17H32O2.Ir/c1-12-9-13(2)11-15(10-12)17-16-6-4-3-5-14(16)7-8-18-17;1-5-16(6-2)10-9-12-11-17(7-3,8-4)15(19)13(12)14(16)18;/h3-10H,1-2H3;12-15,18-19H,5-11H2,1-4H3;/q-1;; |
| InChIKey | JYKANYDOWVBLKX-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.96 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|