C26H20IrN- — CID 170533804
1-(3,5-dimethylbenzene-6-id-1-yl)-5-methylnaphtho[2,1-f]isoquinoline;iridium (PubChem CID 170533804) has the molecular formula C26H20IrN- and a molecular weight of 538.67 g/mol. Its IUPAC name is 1-(3,5-dimethylbenzene-6-id-1-yl)-5-methylnaphtho[2,1-f]isoquinoline;iridium.
| Compound Name | 1-(3,5-dimethylbenzene-6-id-1-yl)-5-methylnaphtho[2,1-f]isoquinoline;iridium |
|---|---|
| PubChem CID | 170533804 |
| Molecular Formula | C26H20IrN- |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | 1-(3,5-dimethylbenzene-6-id-1-yl)-5-methylnaphtho[2,1-f]isoquinoline;iridium |
| SMILES | Cc1[c-]c(-c2nccc3c2ccc2c4ccccc4cc(C)c32)cc(C)c1.[Ir] |
| InChI | InChI=1S/C26H20N.Ir/c1-16-12-17(2)14-20(13-16)26-24-9-8-22-21-7-5-4-6-19(21)15-18(3)25(22)23(24)10-11-27-26;/h4-13,15H,1-3H3;/q-1; |
| InChIKey | RWABOOOTDOJWNT-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|