C46H51IrNO2 — CID 171417961
[(Z)-3,7-diethyl-6-hydroxynon-5-en-4-ylidene]oxidanium;iridium;1-(3-methyl-5-phenylbenzene-2-id-1-yl)-5-propan-2-ylnaphtho[2,1-f]isoquinoline (PubChem CID 171417961) has the molecular formula C46H51IrNO2 and a molecular weight of 842.14 g/mol. Its IUPAC name is [(Z)-3,7-diethyl-6-hydroxynon-5-en-4-ylidene]oxidanium;iridium;1-(3-methyl-5-phenylbenzene-2-id-1-yl)-5-propan-2-ylnaphtho[2,1-f]isoquinoline.
| Compound Name | [(Z)-3,7-diethyl-6-hydroxynon-5-en-4-ylidene]oxidanium;iridium;1-(3-methyl-5-phenylbenzene-2-id-1-yl)-5-propan-2-ylnaphtho[2,1-f]isoquinoline |
|---|---|
| PubChem CID | 171417961 |
| Molecular Formula | C46H51IrNO2 |
| Molecular Weight | 842.14 g/mol |
| Exact Mass | 842.35 |
| IUPAC Name | [(Z)-3,7-diethyl-6-hydroxynon-5-en-4-ylidene]oxidanium;iridium;1-(3-methyl-5-phenylbenzene-2-id-1-yl)-5-propan-2-ylnaphtho[2,1-f]isoquinoline |
| SMILES | Cc1[c-]c(-c2nccc3c2ccc2c4ccccc4cc(C(C)C)c32)cc(-c2ccccc2)c1.[H]/[O+]=C(/C=C(\O)C(CC)CC)C(CC)CC.[Ir] |
| InChI | InChI=1S/C33H26N.C13H24O2.Ir/c1-21(2)31-20-24-11-7-8-12-27(24)28-13-14-30-29(32(28)31)15-16-34-33(30)26-18-22(3)17-25(19-26)23-9-5-4-6-10-23;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h4-17,19-21H,1-3H3;9-11,14H,5-8H2,1-4H3;/q-1;;/p+1/b;12-9-; |
| InChIKey | ZSVDAMUMFGRMRY-DZTQYQPZSA-O |
| XLogP | 12.95 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.14 |
| LogP ≤ 5 | 12.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|