C44H49BiIrNO2- — CID 164733301
1-(3-benzo[b][1]benzobismol-5-yl-5-methylbenzene-6-id-1-yl)-6-propan-2-ylisoquinoline;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium (PubChem CID 164733301) has the molecular formula C44H49BiIrNO2- and a molecular weight of 1025.08 g/mol. Its IUPAC name is 1-(3-benzo[b][1]benzobismol-5-yl-5-methylbenzene-6-id-1-yl)-6-propan-2-ylisoquinoline;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium.
| Compound Name | 1-(3-benzo[b][1]benzobismol-5-yl-5-methylbenzene-6-id-1-yl)-6-propan-2-ylisoquinoline;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 164733301 |
| Molecular Formula | C44H49BiIrNO2- |
| Molecular Weight | 1025.08 g/mol |
| Exact Mass | 1025.32 |
| IUPAC Name | 1-(3-benzo[b][1]benzobismol-5-yl-5-methylbenzene-6-id-1-yl)-6-propan-2-ylisoquinoline;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1[c-]c(-c2nccc3cc(C(C)C)ccc23)cc([Bi]2c3ccccc3-c3ccccc32)c1.[Ir] |
| InChI | InChI=1S/C19H17N.C13H24O2.C12H8.Bi.Ir/c1-13(2)15-7-8-18-16(12-15)9-10-20-19(18)17-6-4-5-14(3)11-17;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;1-3-7-11(8-4-1)12-9-5-2-6-10-12;;/h5-10,12-13H,1-3H3;9-11,14H,5-8H2,1-4H3;1-7,9H;;/q-1;;;;/b;12-9-;;; |
| InChIKey | ZMOCIMAMAAAUHT-AJRJZYOCSA-N |
| XLogP | 9.50 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1025.08 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|