C44H51BiIrNO2- — CID 164733499
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;[3-methyl-5-(6-propan-2-ylisoquinolin-1-yl)benzene-4-id-1-yl]-diphenylbismuthane (PubChem CID 164733499) has the molecular formula C44H51BiIrNO2- and a molecular weight of 1027.09 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;[3-methyl-5-(6-propan-2-ylisoquinolin-1-yl)benzene-4-id-1-yl]-diphenylbismuthane.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;[3-methyl-5-(6-propan-2-ylisoquinolin-1-yl)benzene-4-id-1-yl]-diphenylbismuthane |
|---|---|
| PubChem CID | 164733499 |
| Molecular Formula | C44H51BiIrNO2- |
| Molecular Weight | 1027.09 g/mol |
| Exact Mass | 1027.34 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;[3-methyl-5-(6-propan-2-ylisoquinolin-1-yl)benzene-4-id-1-yl]-diphenylbismuthane |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1[c-]c(-c2nccc3cc(C(C)C)ccc23)cc([Bi](c2ccccc2)c2ccccc2)c1.[Ir] |
| InChI | InChI=1S/C19H17N.C13H24O2.2C6H5.Bi.Ir/c1-13(2)15-7-8-18-16(12-15)9-10-20-19(18)17-6-4-5-14(3)11-17;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;2*1-2-4-6-5-3-1;;/h5-10,12-13H,1-3H3;9-11,14H,5-8H2,1-4H3;2*1-5H;;/q-1;;;;;/b;12-9-;;;; |
| InChIKey | RGINMGRIPLSIDW-WNCSPTOFSA-N |
| XLogP | 9.52 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1027.09 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|