C28H34IrNO2- — CID 170528441
iridium;1-phenylisoquinoline;2,2,6,6-tetramethyl-3,3a,4,5,7,7a-hexahydro-1H-indene-1,7-diol (PubChem CID 170528441) has the molecular formula C28H34IrNO2- and a molecular weight of 608.80 g/mol. Its IUPAC name is iridium;1-phenylisoquinoline;2,2,6,6-tetramethyl-3,3a,4,5,7,7a-hexahydro-1H-indene-1,7-diol.
| Compound Name | iridium;1-phenylisoquinoline;2,2,6,6-tetramethyl-3,3a,4,5,7,7a-hexahydro-1H-indene-1,7-diol |
|---|---|
| PubChem CID | 170528441 |
| Molecular Formula | C28H34IrNO2- |
| Molecular Weight | 608.80 g/mol |
| Exact Mass | 609.22 |
| IUPAC Name | iridium;1-phenylisoquinoline;2,2,6,6-tetramethyl-3,3a,4,5,7,7a-hexahydro-1H-indene-1,7-diol |
| SMILES | CC1(C)CCC2CC(C)(C)C(O)C2C1O.[Ir].[c-]1ccccc1-c1nccc2ccccc12 |
| InChI | InChI=1S/C15H10N.C13H24O2.Ir/c1-2-7-13(8-3-1)15-14-9-5-4-6-12(14)10-11-16-15;1-12(2)6-5-8-7-13(3,4)11(15)9(8)10(12)14;/h1-7,9-11H;8-11,14-15H,5-7H2,1-4H3;/q-1;; |
| InChIKey | MSPWKFZMLNIPQR-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.80 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|