C30H38IrNO2- — CID 170527937
iridium;4-methyl-2-phenylquinoline;2,2,7,7-tetramethyl-1,3,3a,4,5,6,8,8a-octahydroazulene-1,8-diol (PubChem CID 170527937) has the molecular formula C30H38IrNO2- and a molecular weight of 636.86 g/mol. Its IUPAC name is iridium;4-methyl-2-phenylquinoline;2,2,7,7-tetramethyl-1,3,3a,4,5,6,8,8a-octahydroazulene-1,8-diol.
| Compound Name | iridium;4-methyl-2-phenylquinoline;2,2,7,7-tetramethyl-1,3,3a,4,5,6,8,8a-octahydroazulene-1,8-diol |
|---|---|
| PubChem CID | 170527937 |
| Molecular Formula | C30H38IrNO2- |
| Molecular Weight | 636.86 g/mol |
| Exact Mass | 637.25 |
| IUPAC Name | iridium;4-methyl-2-phenylquinoline;2,2,7,7-tetramethyl-1,3,3a,4,5,6,8,8a-octahydroazulene-1,8-diol |
| SMILES | CC1(C)CCCC2CC(C)(C)C(O)C2C1O.Cc1cc(-c2[c-]cccc2)nc2ccccc12.[Ir] |
| InChI | InChI=1S/C16H12N.C14H26O2.Ir/c1-12-11-16(13-7-3-2-4-8-13)17-15-10-6-5-9-14(12)15;1-13(2)7-5-6-9-8-14(3,4)12(16)10(9)11(13)15;/h2-7,9-11H,1H3;9-12,15-16H,5-8H2,1-4H3;/q-1;; |
| InChIKey | JUDINLHJTALHIE-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.86 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|