C32H40IrNO2- — CID 170528175
iridium;5-phenyl-2-phenylpyridine;3,3,6,6-tetramethyl-2,4,4a,5,7,8,9,9a-octahydro-1H-benzo[7]annulene-4,5-diol (PubChem CID 170528175) has the molecular formula C32H40IrNO2- and a molecular weight of 662.89 g/mol. Its IUPAC name is iridium;5-phenyl-2-phenylpyridine;3,3,6,6-tetramethyl-2,4,4a,5,7,8,9,9a-octahydro-1H-benzo[7]annulene-4,5-diol.
| Compound Name | iridium;5-phenyl-2-phenylpyridine;3,3,6,6-tetramethyl-2,4,4a,5,7,8,9,9a-octahydro-1H-benzo[7]annulene-4,5-diol |
|---|---|
| PubChem CID | 170528175 |
| Molecular Formula | C32H40IrNO2- |
| Molecular Weight | 662.89 g/mol |
| Exact Mass | 663.27 |
| IUPAC Name | iridium;5-phenyl-2-phenylpyridine;3,3,6,6-tetramethyl-2,4,4a,5,7,8,9,9a-octahydro-1H-benzo[7]annulene-4,5-diol |
| SMILES | CC1(C)CCCC2CCC(C)(C)C(O)C2C1O.[Ir].[c-]1ccccc1-c1ccc(-c2ccccc2)cn1 |
| InChI | InChI=1S/C17H12N.C15H28O2.Ir/c1-3-7-14(8-4-1)16-11-12-17(18-13-16)15-9-5-2-6-10-15;1-14(2)8-5-6-10-7-9-15(3,4)13(17)11(10)12(14)16;/h1-9,11-13H;10-13,16-17H,5-9H2,1-4H3;/q-1;; |
| InChIKey | HQNBBMCJNXRZAR-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.89 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|