C31H38IrNO2- — CID 170527502
(2R,9S)-2,9-dimethyl-1,2,3,4,5,5a,6,7,8,9,10,10a-dodecahydroheptalene-1,10-diol;iridium;5-phenyl-2-phenylpyridine (PubChem CID 170527502) has the molecular formula C31H38IrNO2- and a molecular weight of 648.87 g/mol. Its IUPAC name is (2R,9S)-2,9-dimethyl-1,2,3,4,5,5a,6,7,8,9,10,10a-dodecahydroheptalene-1,10-diol;iridium;5-phenyl-2-phenylpyridine.
| Compound Name | (2R,9S)-2,9-dimethyl-1,2,3,4,5,5a,6,7,8,9,10,10a-dodecahydroheptalene-1,10-diol;iridium;5-phenyl-2-phenylpyridine |
|---|---|
| PubChem CID | 170527502 |
| Molecular Formula | C31H38IrNO2- |
| Molecular Weight | 648.87 g/mol |
| Exact Mass | 649.25 |
| IUPAC Name | (2R,9S)-2,9-dimethyl-1,2,3,4,5,5a,6,7,8,9,10,10a-dodecahydroheptalene-1,10-diol;iridium;5-phenyl-2-phenylpyridine |
| SMILES | C[C@@H]1CCCC2CCC[C@H](C)C(O)C2C1O.[Ir].[c-]1ccccc1-c1ccc(-c2ccccc2)cn1 |
| InChI | InChI=1S/C17H12N.C14H26O2.Ir/c1-3-7-14(8-4-1)16-11-12-17(18-13-16)15-9-5-2-6-10-15;1-9-5-3-7-11-8-4-6-10(2)14(16)12(11)13(9)15;/h1-9,11-13H;9-16H,3-8H2,1-2H3;/q-1;;/t;9-,10+,11?,12?,13?,14?; |
| InChIKey | YZTUPEAMBACPBY-YMLBIPENSA-N |
| XLogP | 6.79 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.87 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|