C28H34IrNO2- — CID 170527703
1,2,3,4,5,5a,6,7,8,9,10,10a-dodecahydroheptalene-1,10-diol;iridium;5-methyl-3-phenylisoquinoline (PubChem CID 170527703) has the molecular formula C28H34IrNO2- and a molecular weight of 608.80 g/mol. Its IUPAC name is 1,2,3,4,5,5a,6,7,8,9,10,10a-dodecahydroheptalene-1,10-diol;iridium;5-methyl-3-phenylisoquinoline.
| Compound Name | 1,2,3,4,5,5a,6,7,8,9,10,10a-dodecahydroheptalene-1,10-diol;iridium;5-methyl-3-phenylisoquinoline |
|---|---|
| PubChem CID | 170527703 |
| Molecular Formula | C28H34IrNO2- |
| Molecular Weight | 608.80 g/mol |
| Exact Mass | 609.22 |
| IUPAC Name | 1,2,3,4,5,5a,6,7,8,9,10,10a-dodecahydroheptalene-1,10-diol;iridium;5-methyl-3-phenylisoquinoline |
| SMILES | Cc1cccc2cnc(-c3[c-]cccc3)cc12.OC1CCCCC2CCCCC(O)C12.[Ir] |
| InChI | InChI=1S/C16H12N.C12H22O2.Ir/c1-12-6-5-9-14-11-17-16(10-15(12)14)13-7-3-2-4-8-13;13-10-7-3-1-5-9-6-2-4-8-11(14)12(9)10;/h2-7,9-11H,1H3;9-14H,1-8H2;/q-1;; |
| InChIKey | HQGQWEGOZDPRTA-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.80 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|