C30H32IrNO2- — CID 170527822
2,3,4,4a,5,6,7,8,9,9a-decahydro-1H-benzo[7]annulene-4,5-diol;iridium;2-phenylbenzo[h]quinoline (PubChem CID 170527822) has the molecular formula C30H32IrNO2- and a molecular weight of 630.81 g/mol. Its IUPAC name is 2,3,4,4a,5,6,7,8,9,9a-decahydro-1H-benzo[7]annulene-4,5-diol;iridium;2-phenylbenzo[h]quinoline.
| Compound Name | 2,3,4,4a,5,6,7,8,9,9a-decahydro-1H-benzo[7]annulene-4,5-diol;iridium;2-phenylbenzo[h]quinoline |
|---|---|
| PubChem CID | 170527822 |
| Molecular Formula | C30H32IrNO2- |
| Molecular Weight | 630.81 g/mol |
| Exact Mass | 631.21 |
| IUPAC Name | 2,3,4,4a,5,6,7,8,9,9a-decahydro-1H-benzo[7]annulene-4,5-diol;iridium;2-phenylbenzo[h]quinoline |
| SMILES | OC1CCCCC2CCCC(O)C12.[Ir].[c-]1ccccc1-c1ccc2ccc3ccccc3c2n1 |
| InChI | InChI=1S/C19H12N.C11H20O2.Ir/c1-2-7-15(8-3-1)18-13-12-16-11-10-14-6-4-5-9-17(14)19(16)20-18;12-9-6-2-1-4-8-5-3-7-10(13)11(8)9;/h1-7,9-13H;8-13H,1-7H2;/q-1;; |
| InChIKey | WDBIPFBUSHPLOG-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.81 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|